C27H31F3O — CID 139983619
1-nonyl-4-[2-[4-[(E)-4,4,4-trifluorobut-2-enoxy]phenyl]ethynyl]benzene (PubChem CID 139983619) has the molecular formula C27H31F3O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-nonyl-4-[2-[4-[(E)-4,4,4-trifluorobut-2-enoxy]phenyl]ethynyl]benzene.
| Compound Name | 1-nonyl-4-[2-[4-[(E)-4,4,4-trifluorobut-2-enoxy]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 139983619 |
| Molecular Formula | C27H31F3O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-nonyl-4-[2-[4-[(E)-4,4,4-trifluorobut-2-enoxy]phenyl]ethynyl]benzene |
| SMILES | CCCCCCCCCc1ccc(C#Cc2ccc(OC/C=C/C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H31F3O/c1-2-3-4-5-6-7-8-10-23-11-13-24(14-12-23)15-16-25-17-19-26(20-18-25)31-22-9-21-27(28,29)30/h9,11-14,17-21H,2-8,10,22H2,1H3/b21-9+ |
| InChIKey | TZLSGSSTGRMPSK-ZVBGSRNCSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|