C25H25F3N2O — CID 54493706
5-pentyl-2-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]pyrimidine (PubChem CID 54493706) has the molecular formula C25H25F3N2O and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-pentyl-2-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]pyrimidine.
| Compound Name | 5-pentyl-2-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 54493706 |
| Molecular Formula | C25H25F3N2O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-pentyl-2-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]pyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc(-c3ccc(OCC=CC(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C25H25F3N2O/c1-2-3-4-6-19-17-29-24(30-18-19)22-9-7-20(8-10-22)21-11-13-23(14-12-21)31-16-5-15-25(26,27)28/h5,7-15,17-18H,2-4,6,16H2,1H3 |
| InChIKey | XXOSEHYVWKAXMO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|