C27H27F15N2O — CID 15869790
5-nonyl-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]pyrimidine (PubChem CID 15869790) has the molecular formula C27H27F15N2O and a molecular weight of 680.50 g/mol. Its IUPAC name is 5-nonyl-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]pyrimidine.
| Compound Name | 5-nonyl-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 15869790 |
| Molecular Formula | C27H27F15N2O |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 5-nonyl-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C27H27F15N2O/c1-2-3-4-5-6-7-8-9-17-14-43-20(44-15-17)18-10-12-19(13-11-18)45-16-21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)42/h10-15H,2-9,16H2,1H3 |
| InChIKey | FARBAYBAKVSSOP-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|