C25H25F13N2 — CID 23355742
5-nonyl-2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]pyrimidine (PubChem CID 23355742) has the molecular formula C25H25F13N2 and a molecular weight of 600.46 g/mol. Its IUPAC name is 5-nonyl-2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]pyrimidine.
| Compound Name | 5-nonyl-2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 23355742 |
| Molecular Formula | C25H25F13N2 |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 5-nonyl-2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]pyrimidine |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C25H25F13N2/c1-2-3-4-5-6-7-8-9-16-14-39-19(40-15-16)17-10-12-18(13-11-17)20(26,27)21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)38/h10-15H,2-9H2,1H3 |
| InChIKey | SAIIJBMVJMDYFO-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|