C38H44F8N4O2 — CID 88635473
5-hexyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine;5-octyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine (PubChem CID 88635473) has the molecular formula C38H44F8N4O2 and a molecular weight of 740.78 g/mol. Its IUPAC name is 5-hexyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine;5-octyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine.
| Compound Name | 5-hexyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine;5-octyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 88635473 |
| Molecular Formula | C38H44F8N4O2 |
| Molecular Weight | 740.78 g/mol |
| Exact Mass | 740.33 |
| IUPAC Name | 5-hexyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine;5-octyl-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(F)(F)C(F)F)cc2)nc1.CCCCCCc1cnc(-c2ccc(OC(F)(F)C(F)F)cc2)nc1 |
| InChI | InChI=1S/C20H24F4N2O.C18H20F4N2O/c1-2-3-4-5-6-7-8-15-13-25-18(26-14-15)16-9-11-17(12-10-16)27-20(23,24)19(21)22;1-2-3-4-5-6-13-11-23-16(24-12-13)14-7-9-15(10-8-14)25-18(21,22)17(19)20/h9-14,19H,2-8H2,1H3;7-12,17H,2-6H2,1H3 |
| InChIKey | AWDTZOHFURPAGE-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.78 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|