C26H23F3O — CID 139862619
2-but-2-enoxy-6-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-1-fluoronaphthalene (PubChem CID 139862619) has the molecular formula C26H23F3O and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-but-2-enoxy-6-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-1-fluoronaphthalene.
| Compound Name | 2-but-2-enoxy-6-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139862619 |
| Molecular Formula | C26H23F3O |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-but-2-enoxy-6-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc(C(F)=C(F)c2ccc3c(F)c(OCC=CC)ccc3c2)cc1 |
| InChI | InChI=1S/C26H23F3O/c1-3-5-7-18-8-10-19(11-9-18)24(27)25(28)21-12-14-22-20(17-21)13-15-23(26(22)29)30-16-6-4-2/h3-4,6,8-15,17H,1,5,7,16H2,2H3 |
| InChIKey | LTEYBAAQVGTQKH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|