C27H31F3 — CID 139860885
2-but-3-enyl-6-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1-fluoronaphthalene (PubChem CID 139860885) has the molecular formula C27H31F3 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-but-3-enyl-6-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1-fluoronaphthalene.
| Compound Name | 2-but-3-enyl-6-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139860885 |
| Molecular Formula | C27H31F3 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-but-3-enyl-6-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc2cc(C(F)=C(F)C3CCC(CC/C=C/C)CC3)ccc2c1F |
| InChI | InChI=1S/C27H31F3/c1-3-5-7-8-19-10-12-21(13-11-19)26(29)27(30)23-16-17-24-22(18-23)15-14-20(25(24)28)9-6-4-2/h3-5,14-19,21H,2,6-13H2,1H3/b5-3+,27-26? |
| InChIKey | ZBLFWRNQQFQZJJ-NAQVWMEPSA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|