C26H29F5 — CID 139861546
3-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1,2,8-trifluoro-7-propylnaphthalene (PubChem CID 139861546) has the molecular formula C26H29F5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1,2,8-trifluoro-7-propylnaphthalene.
| Compound Name | 3-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1,2,8-trifluoro-7-propylnaphthalene |
|---|---|
| PubChem CID | 139861546 |
| Molecular Formula | C26H29F5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[1,2-difluoro-2-[4-[(E)-pent-3-enyl]cyclohexyl]ethenyl]-1,2,8-trifluoro-7-propylnaphthalene |
| SMILES | C/C=C/CCC1CCC(C(F)=C(F)c2cc3ccc(CCC)c(F)c3c(F)c2F)CC1 |
| InChI | InChI=1S/C26H29F5/c1-3-5-6-8-16-9-11-18(12-10-16)23(28)24(29)20-15-19-14-13-17(7-4-2)22(27)21(19)26(31)25(20)30/h3,5,13-16,18H,4,6-12H2,1-2H3/b5-3+,24-23? |
| InChIKey | XQVWMYCLSGIVMA-DONROWTLSA-N |
| XLogP | 8.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|