C34H39F3 — CID 154607361
2,3-difluoro-1-[2-fluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethyl]phenyl]-4-propylbenzene (PubChem CID 154607361) has the molecular formula C34H39F3 and a molecular weight of 504.68 g/mol. Its IUPAC name is 2,3-difluoro-1-[2-fluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethyl]phenyl]-4-propylbenzene.
| Compound Name | 2,3-difluoro-1-[2-fluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethyl]phenyl]-4-propylbenzene |
|---|---|
| PubChem CID | 154607361 |
| Molecular Formula | C34H39F3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 2,3-difluoro-1-[2-fluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethyl]phenyl]-4-propylbenzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(CCc3ccc(-c4ccc(CCC)c(F)c4F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C34H39F3/c1-3-5-6-8-24-11-16-27(17-12-24)28-18-13-25(14-19-28)9-10-26-15-21-30(32(35)23-26)31-22-20-29(7-4-2)33(36)34(31)37/h3,5,13-15,18-24,27H,4,6-12,16-17H2,1-2H3/b5-3+ |
| InChIKey | BZNSDSRBVJYKIB-HWKANZROSA-N |
| XLogP | 10.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|