C30H32F4 — CID 139872751
1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene (PubChem CID 139872751) has the molecular formula C30H32F4 and a molecular weight of 468.58 g/mol. Its IUPAC name is 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139872751 |
| Molecular Formula | C30H32F4 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 1-fluoro-6-[4-[(E)-pent-3-enyl]cyclohexyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]naphthalene |
| SMILES | C/C=C/CCC1CCC(c2ccc3c(F)c(CCc4ccc(C(F)(F)F)cc4)ccc3c2)CC1 |
| InChI | InChI=1S/C30H32F4/c1-2-3-4-5-21-6-11-23(12-7-21)25-16-19-28-26(20-25)15-14-24(29(28)31)13-8-22-9-17-27(18-10-22)30(32,33)34/h2-3,9-10,14-21,23H,4-8,11-13H2,1H3/b3-2+ |
| InChIKey | JQCJAKRURPUYMP-NSCUHMNNSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|