C30H31F5O — CID 139874600
6-(4-but-3-enylcyclohexyl)-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene (PubChem CID 139874600) has the molecular formula C30H31F5O and a molecular weight of 502.57 g/mol. Its IUPAC name is 6-(4-but-3-enylcyclohexyl)-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-(4-but-3-enylcyclohexyl)-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139874600 |
| Molecular Formula | C30H31F5O |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 6-(4-but-3-enylcyclohexyl)-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
| SMILES | C=CCCC1CCC(c2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C30H31F5O/c1-2-3-4-20-5-9-22(10-6-20)24-14-15-26-25(18-24)13-12-23(29(26)32)11-7-21-8-16-28(27(31)17-21)36-19-30(33,34)35/h2,8,12-18,20,22H,1,3-7,9-11,19H2 |
| InChIKey | IQRNITNSONZLBK-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|