C31H35F3 — CID 139861346
3-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoro-7-[(E)-pent-3-enyl]naphthalene (PubChem CID 139861346) has the molecular formula C31H35F3 and a molecular weight of 464.62 g/mol. Its IUPAC name is 3-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoro-7-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 3-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoro-7-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139861346 |
| Molecular Formula | C31H35F3 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 3-[4-[2-(4-ethylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoro-7-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2cc(-c3ccc(CCC4CCC(CC)CC4)cc3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C31H35F3/c1-3-5-6-7-25-18-19-26-20-27(30(33)31(34)28(26)29(25)32)24-16-14-23(15-17-24)13-12-22-10-8-21(4-2)9-11-22/h3,5,14-22H,4,6-13H2,1-2H3/b5-3+ |
| InChIKey | ATYNBOCVFBSDAV-HWKANZROSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|