C24H21F3 — CID 139861232
7-but-3-enyl-3-(4-but-3-enylphenyl)-1,2,8-trifluoronaphthalene (PubChem CID 139861232) has the molecular formula C24H21F3 and a molecular weight of 366.43 g/mol. Its IUPAC name is 7-but-3-enyl-3-(4-but-3-enylphenyl)-1,2,8-trifluoronaphthalene.
| Compound Name | 7-but-3-enyl-3-(4-but-3-enylphenyl)-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139861232 |
| Molecular Formula | C24H21F3 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 7-but-3-enyl-3-(4-but-3-enylphenyl)-1,2,8-trifluoronaphthalene |
| SMILES | C=CCCc1ccc(-c2cc3ccc(CCC=C)c(F)c3c(F)c2F)cc1 |
| InChI | InChI=1S/C24H21F3/c1-3-5-7-16-9-11-17(12-10-16)20-15-19-14-13-18(8-6-4-2)22(25)21(19)24(27)23(20)26/h3-4,9-15H,1-2,5-8H2 |
| InChIKey | DRLGEFGREMBJNG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|