C28H27F3 — CID 139862731
7-ethenyl-3-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoronaphthalene (PubChem CID 139862731) has the molecular formula C28H27F3 and a molecular weight of 420.52 g/mol. Its IUPAC name is 7-ethenyl-3-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoronaphthalene.
| Compound Name | 7-ethenyl-3-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139862731 |
| Molecular Formula | C28H27F3 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 7-ethenyl-3-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]-1,2,8-trifluoronaphthalene |
| SMILES | C=Cc1ccc2cc(-c3ccc(CCC4CCC(C=C)CC4)cc3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C28H27F3/c1-3-18-5-7-19(8-6-18)9-10-20-11-13-22(14-12-20)24-17-23-16-15-21(4-2)26(29)25(23)28(31)27(24)30/h3-4,11-19H,1-2,5-10H2 |
| InChIKey | UUIMQONCEQEECE-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|