C31H33F3 — CID 139861882
3-ethenyl-1,2,8-trifluoro-7-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]naphthalene (PubChem CID 139861882) has the molecular formula C31H33F3 and a molecular weight of 462.60 g/mol. Its IUPAC name is 3-ethenyl-1,2,8-trifluoro-7-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]naphthalene.
| Compound Name | 3-ethenyl-1,2,8-trifluoro-7-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 139861882 |
| Molecular Formula | C31H33F3 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-ethenyl-1,2,8-trifluoro-7-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]naphthalene |
| SMILES | C=Cc1cc2ccc(-c3ccc(CCC4CCC(CC/C=C/C)CC4)cc3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C31H33F3/c1-3-5-6-7-21-8-10-22(11-9-21)12-13-23-14-16-25(17-15-23)27-19-18-26-20-24(4-2)29(32)31(34)28(26)30(27)33/h3-5,14-22H,2,6-13H2,1H3/b5-3+ |
| InChIKey | BYYDNKRXSKEOGF-HWKANZROSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|