C31H31F3 — CID 139858932
1,2,3-trifluoro-6-[2-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]ethynyl]naphthalene (PubChem CID 139858932) has the molecular formula C31H31F3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1,2,3-trifluoro-6-[2-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1,2,3-trifluoro-6-[2-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139858932 |
| Molecular Formula | C31H31F3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1,2,3-trifluoro-6-[2-[4-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCC1CCC(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)CC1 |
| InChI | InChI=1S/C31H31F3/c1-2-3-4-5-22-6-8-23(9-7-22)10-11-24-12-14-25(15-13-24)16-17-26-18-19-28-27(20-26)21-29(32)31(34)30(28)33/h2-3,12-15,18-23H,4-11H2,1H3/b3-2+ |
| InChIKey | XSKHKVQAFJTUGO-NSCUHMNNSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|