C26H27F5 — CID 139861089
3-but-3-enyl-7-[2-(4-but-3-enylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoronaphthalene (PubChem CID 139861089) has the molecular formula C26H27F5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 3-but-3-enyl-7-[2-(4-but-3-enylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoronaphthalene.
| Compound Name | 3-but-3-enyl-7-[2-(4-but-3-enylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139861089 |
| Molecular Formula | C26H27F5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-but-3-enyl-7-[2-(4-but-3-enylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoronaphthalene |
| SMILES | C=CCCc1cc2ccc(C(F)=C(F)C3CCC(CCC=C)CC3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C26H27F5/c1-3-5-7-16-9-11-17(12-10-16)22(27)25(30)20-14-13-18-15-19(8-6-4-2)23(28)26(31)21(18)24(20)29/h3-4,13-17H,1-2,5-12H2 |
| InChIKey | SRUMWOOXIRBFEB-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|