C24H26F2 — CID 139861561
2-but-3-enyl-6-[2-(4-ethenylcyclohexyl)-1,2-difluoroethenyl]naphthalene (PubChem CID 139861561) has the molecular formula C24H26F2 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-but-3-enyl-6-[2-(4-ethenylcyclohexyl)-1,2-difluoroethenyl]naphthalene.
| Compound Name | 2-but-3-enyl-6-[2-(4-ethenylcyclohexyl)-1,2-difluoroethenyl]naphthalene |
|---|---|
| PubChem CID | 139861561 |
| Molecular Formula | C24H26F2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-but-3-enyl-6-[2-(4-ethenylcyclohexyl)-1,2-difluoroethenyl]naphthalene |
| SMILES | C=CCCc1ccc2cc(C(F)=C(F)C3CCC(C=C)CC3)ccc2c1 |
| InChI | InChI=1S/C24H26F2/c1-3-5-6-18-9-12-21-16-22(14-13-20(21)15-18)24(26)23(25)19-10-7-17(4-2)8-11-19/h3-4,9,12-17,19H,1-2,5-8,10-11H2 |
| InChIKey | RCMKRIGVUYSKQG-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|