C25H23F3 — CID 139862628
6-but-3-enyl-2-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-1-fluoronaphthalene (PubChem CID 139862628) has the molecular formula C25H23F3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 6-but-3-enyl-2-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-1-fluoronaphthalene.
| Compound Name | 6-but-3-enyl-2-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139862628 |
| Molecular Formula | C25H23F3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-but-3-enyl-2-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc2c(F)c(C(F)=C(F)c3ccc(CCC)cc3)ccc2c1 |
| InChI | InChI=1S/C25H23F3/c1-3-5-7-18-10-14-21-20(16-18)13-15-22(24(21)27)25(28)23(26)19-11-8-17(6-4-2)9-12-19/h3,8-16H,1,4-7H2,2H3 |
| InChIKey | FICQYZFYJSNYLV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|