C23H19F5O — CID 139862507
7-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-3-ethoxy-1,2,8-trifluoronaphthalene (PubChem CID 139862507) has the molecular formula C23H19F5O and a molecular weight of 406.39 g/mol. Its IUPAC name is 7-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-3-ethoxy-1,2,8-trifluoronaphthalene.
| Compound Name | 7-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-3-ethoxy-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139862507 |
| Molecular Formula | C23H19F5O |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 7-[1,2-difluoro-2-(4-propylphenyl)ethenyl]-3-ethoxy-1,2,8-trifluoronaphthalene |
| SMILES | CCCc1ccc(C(F)=C(F)c2ccc3cc(OCC)c(F)c(F)c3c2F)cc1 |
| InChI | InChI=1S/C23H19F5O/c1-3-5-13-6-8-14(9-7-13)19(24)21(26)16-11-10-15-12-17(29-4-2)22(27)23(28)18(15)20(16)25/h6-12H,3-5H2,1-2H3 |
| InChIKey | IXLRSSOFKLADMT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|