C30H26F4O — CID 70935174
1-(4-butylphenyl)-4-[(E)-2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]naphthalene (PubChem CID 70935174) has the molecular formula C30H26F4O and a molecular weight of 478.53 g/mol. Its IUPAC name is 1-(4-butylphenyl)-4-[(E)-2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]naphthalene.
| Compound Name | 1-(4-butylphenyl)-4-[(E)-2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]naphthalene |
|---|---|
| PubChem CID | 70935174 |
| Molecular Formula | C30H26F4O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-(4-butylphenyl)-4-[(E)-2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]naphthalene |
| SMILES | CCCCc1ccc(-c2ccc(/C(F)=C(\F)c3ccc(OCC)c(F)c3F)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H26F4O/c1-3-5-8-19-11-13-20(14-12-19)21-15-16-24(23-10-7-6-9-22(21)23)27(31)28(32)25-17-18-26(35-4-2)30(34)29(25)33/h6-7,9-18H,3-5,8H2,1-2H3/b28-27+ |
| InChIKey | IGHWSMMDDQMRBT-BYYHNAKLSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|