C34H32F4 — CID 77486558
1,4-bis[2-(4-butylphenyl)-1,2-difluoroethenyl]naphthalene (PubChem CID 77486558) has the molecular formula C34H32F4 and a molecular weight of 516.62 g/mol. Its IUPAC name is 1,4-bis[2-(4-butylphenyl)-1,2-difluoroethenyl]naphthalene.
| Compound Name | 1,4-bis[2-(4-butylphenyl)-1,2-difluoroethenyl]naphthalene |
|---|---|
| PubChem CID | 77486558 |
| Molecular Formula | C34H32F4 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 1,4-bis[2-(4-butylphenyl)-1,2-difluoroethenyl]naphthalene |
| SMILES | CCCCc1ccc(C(F)=C(F)c2ccc(C(F)=C(F)c3ccc(CCCC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C34H32F4/c1-3-5-9-23-13-17-25(18-14-23)31(35)33(37)29-21-22-30(28-12-8-7-11-27(28)29)34(38)32(36)26-19-15-24(16-20-26)10-6-4-2/h7-8,11-22H,3-6,9-10H2,1-2H3 |
| InChIKey | CXYNOVCVTWMJNH-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|