C24H26F2 — CID 118911708
1-butyl-4-[(3Z)-5-(4-ethylphenyl)-3,4-difluorohexa-1,3,5-trien-2-yl]benzene (PubChem CID 118911708) has the molecular formula C24H26F2 and a molecular weight of 352.47 g/mol. Its IUPAC name is 1-butyl-4-[(3Z)-5-(4-ethylphenyl)-3,4-difluorohexa-1,3,5-trien-2-yl]benzene.
| Compound Name | 1-butyl-4-[(3Z)-5-(4-ethylphenyl)-3,4-difluorohexa-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 118911708 |
| Molecular Formula | C24H26F2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-butyl-4-[(3Z)-5-(4-ethylphenyl)-3,4-difluorohexa-1,3,5-trien-2-yl]benzene |
| SMILES | C=C(/C(F)=C(/F)C(=C)c1ccc(CCCC)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H26F2/c1-5-7-8-20-11-15-22(16-12-20)18(4)24(26)23(25)17(3)21-13-9-19(6-2)10-14-21/h9-16H,3-8H2,1-2H3/b24-23- |
| InChIKey | LAUMXHAYGFJWSO-VHXPQNKSSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|