C30H42F2 — CID 70184913
1-[(E)-1,2-difluoronon-1-enyl]-4-(4-nonylphenyl)benzene (PubChem CID 70184913) has the molecular formula C30H42F2 and a molecular weight of 440.66 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoronon-1-enyl]-4-(4-nonylphenyl)benzene.
| Compound Name | 1-[(E)-1,2-difluoronon-1-enyl]-4-(4-nonylphenyl)benzene |
|---|---|
| PubChem CID | 70184913 |
| Molecular Formula | C30H42F2 |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 1-[(E)-1,2-difluoronon-1-enyl]-4-(4-nonylphenyl)benzene |
| SMILES | CCCCCCCCCc1ccc(-c2ccc(/C(F)=C(\F)CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H42F2/c1-3-5-7-9-10-12-13-15-25-17-19-26(20-18-25)27-21-23-28(24-22-27)30(32)29(31)16-14-11-8-6-4-2/h17-24H,3-16H2,1-2H3/b30-29+ |
| InChIKey | SYAWANTWVIIAOU-QVIHXGFCSA-N |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|