C19H20F2 — CID 70028026
1-[(Z)-1,2-difluorohex-1-enyl]-4-(4-methylphenyl)benzene (PubChem CID 70028026) has the molecular formula C19H20F2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[(Z)-1,2-difluorohex-1-enyl]-4-(4-methylphenyl)benzene.
| Compound Name | 1-[(Z)-1,2-difluorohex-1-enyl]-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 70028026 |
| Molecular Formula | C19H20F2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[(Z)-1,2-difluorohex-1-enyl]-4-(4-methylphenyl)benzene |
| SMILES | CCCC/C(F)=C(/F)c1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20F2/c1-3-4-5-18(20)19(21)17-12-10-16(11-13-17)15-8-6-14(2)7-9-15/h6-13H,3-5H2,1-2H3/b19-18- |
| InChIKey | ITTYVAGUELCDCL-HNENSFHCSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |