C33H32F2 — CID 67950330
1-(4-butylphenyl)-4-[4-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]phenyl]-2-ethylbenzene (PubChem CID 67950330) has the molecular formula C33H32F2 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-(4-butylphenyl)-4-[4-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]phenyl]-2-ethylbenzene.
| Compound Name | 1-(4-butylphenyl)-4-[4-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]phenyl]-2-ethylbenzene |
|---|---|
| PubChem CID | 67950330 |
| Molecular Formula | C33H32F2 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-(4-butylphenyl)-4-[4-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]phenyl]-2-ethylbenzene |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc(/C(F)=C(\F)c4ccc(C)cc4)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C33H32F2/c1-4-6-7-24-10-14-27(15-11-24)31-21-20-30(22-25(31)5-2)26-16-18-29(19-17-26)33(35)32(34)28-12-8-23(3)9-13-28/h8-22H,4-7H2,1-3H3/b33-32+ |
| InChIKey | YFICDCBDMCVPFG-ULIFNZDWSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|