C26H30O — CID 118150545
3-[3-ethyl-4-[3-ethyl-4-(4-methylphenyl)phenyl]phenyl]propan-1-ol (PubChem CID 118150545) has the molecular formula C26H30O and a molecular weight of 358.53 g/mol. Its IUPAC name is 3-[3-ethyl-4-[3-ethyl-4-(4-methylphenyl)phenyl]phenyl]propan-1-ol.
| Compound Name | 3-[3-ethyl-4-[3-ethyl-4-(4-methylphenyl)phenyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 118150545 |
| Molecular Formula | C26H30O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-[3-ethyl-4-[3-ethyl-4-(4-methylphenyl)phenyl]phenyl]propan-1-ol |
| SMILES | CCc1cc(CCCO)ccc1-c1ccc(-c2ccc(C)cc2)c(CC)c1 |
| InChI | InChI=1S/C26H30O/c1-4-21-17-20(7-6-16-27)10-14-26(21)24-13-15-25(22(5-2)18-24)23-11-8-19(3)9-12-23/h8-15,17-18,27H,4-7,16H2,1-3H3 |
| InChIKey | LEVRBRFWHRHEGL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |