About 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid
2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid (PubChem CID 70027722) has the molecular formula C20H18F4O2
and a molecular weight of 366.35 g/mol. Its IUPAC name is 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid |
| PubChem CID | 70027722 |
| Molecular Formula | C20H18F4O2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid |
| SMILES | CCCCCC(F)=C(F)c1ccc(-c2c(C(=O)O)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C20H18F4O2/c1-2-3-4-5-15(21)18(23)13-8-6-12(7-9-13)17-14(20(25)26)10-11-16(22)19(17)24/h6-11H,2-5H2,1H3,(H,25,26) |
| InChIKey | MUKOWDZYLSBXDG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid?
The IUPAC name of 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid (CID 70027722) is 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid.
What is the SMILES notation for 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid?
The canonical SMILES for 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid is CCCCCC(F)=C(F)c1ccc(-c2c(C(=O)O)ccc(F)c2F)cc1.
What is the InChIKey of 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid?
The InChIKey is MUKOWDZYLSBXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F4O2/c1-2-3-4-5-15(21)18(23)13-8-6-12(7-9-13)17-14(20(25)26)10-11-16(22)19(17)24/h6-11H,2-5H2,1H3,(H,25,26).
What are the key properties of 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid?
2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid has a molecular weight of 366.35 g/mol, XLogP of 6.52, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2-difluorohept-1-enyl)phenyl]-3,4-difluorobenzoic acid is sourced from PubChem (CID 70027722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).