C20H18F4O2 — CID 22991441
2-[4-[(E)-1,2-difluorohept-1-enyl]phenyl]-3,4-difluorobenzoic acid (PubChem CID 22991441) has the molecular formula C20H18F4O2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 2-[4-[(E)-1,2-difluorohept-1-enyl]phenyl]-3,4-difluorobenzoic acid.
| Compound Name | 2-[4-[(E)-1,2-difluorohept-1-enyl]phenyl]-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 22991441 |
| Molecular Formula | C20H18F4O2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[4-[(E)-1,2-difluorohept-1-enyl]phenyl]-3,4-difluorobenzoic acid |
| SMILES | CCCCC/C(F)=C(\F)c1ccc(-c2c(C(=O)O)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C20H18F4O2/c1-2-3-4-5-15(21)18(23)13-8-6-12(7-9-13)17-14(20(25)26)10-11-16(22)19(17)24/h6-11H,2-5H2,1H3,(H,25,26)/b18-15+ |
| InChIKey | MUKOWDZYLSBXDG-OBGWFSINSA-N |
| XLogP | 6.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|