C18H17F3 — CID 22991430
1-[(E)-1,2-difluorohex-1-enyl]-4-(4-fluorophenyl)benzene (PubChem CID 22991430) has the molecular formula C18H17F3 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-[(E)-1,2-difluorohex-1-enyl]-4-(4-fluorophenyl)benzene.
| Compound Name | 1-[(E)-1,2-difluorohex-1-enyl]-4-(4-fluorophenyl)benzene |
|---|---|
| PubChem CID | 22991430 |
| Molecular Formula | C18H17F3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(E)-1,2-difluorohex-1-enyl]-4-(4-fluorophenyl)benzene |
| SMILES | CCCC/C(F)=C(\F)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H17F3/c1-2-3-4-17(20)18(21)15-7-5-13(6-8-15)14-9-11-16(19)12-10-14/h5-12H,2-4H2,1H3/b18-17+ |
| InChIKey | YWJPZGRTDLGJQC-ISLYRVAYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |