C31H42F2 — CID 22991563
1-[(E)-1,2-difluorooct-1-enyl]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene (PubChem CID 22991563) has the molecular formula C31H42F2 and a molecular weight of 452.67 g/mol. Its IUPAC name is 1-[(E)-1,2-difluorooct-1-enyl]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene.
| Compound Name | 1-[(E)-1,2-difluorooct-1-enyl]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 22991563 |
| Molecular Formula | C31H42F2 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 1-[(E)-1,2-difluorooct-1-enyl]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene |
| SMILES | CCCCCC/C(F)=C(\F)c1ccc(CCc2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H42F2/c1-3-5-6-7-9-30(32)31(33)29-22-16-26(17-23-29)11-10-25-14-20-28(21-15-25)27-18-12-24(8-4-2)13-19-27/h14-17,20-24,27H,3-13,18-19H2,1-2H3/b31-30+ |
| InChIKey | HVMLNLUBQMLXRM-NVQSTNCTSA-N |
| XLogP | 10.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|