C26H34F2O — CID 22991350
1-[(Z)-1,2-difluoropent-1-enyl]-4-[(4-octylphenyl)methoxy]benzene (PubChem CID 22991350) has the molecular formula C26H34F2O and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-[(Z)-1,2-difluoropent-1-enyl]-4-[(4-octylphenyl)methoxy]benzene.
| Compound Name | 1-[(Z)-1,2-difluoropent-1-enyl]-4-[(4-octylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 22991350 |
| Molecular Formula | C26H34F2O |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[(Z)-1,2-difluoropent-1-enyl]-4-[(4-octylphenyl)methoxy]benzene |
| SMILES | CCCCCCCCc1ccc(COc2ccc(/C(F)=C(/F)CCC)cc2)cc1 |
| InChI | InChI=1S/C26H34F2O/c1-3-5-6-7-8-9-11-21-12-14-22(15-13-21)20-29-24-18-16-23(17-19-24)26(28)25(27)10-4-2/h12-19H,3-11,20H2,1-2H3/b26-25- |
| InChIKey | NHPHAXIAQKWKRS-QPLCGJKRSA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|