C21H28O — CID 59265322
4-[(4-hexylphenyl)methoxy]-1,2-dimethylbenzene (PubChem CID 59265322) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-[(4-hexylphenyl)methoxy]-1,2-dimethylbenzene.
| Compound Name | 4-[(4-hexylphenyl)methoxy]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 59265322 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 4-[(4-hexylphenyl)methoxy]-1,2-dimethylbenzene |
| SMILES | CCCCCCc1ccc(COc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H28O/c1-4-5-6-7-8-19-10-12-20(13-11-19)16-22-21-14-9-17(2)18(3)15-21/h9-15H,4-8,16H2,1-3H3 |
| InChIKey | QQSJQUKONQUXIY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|