C21H23F3 — CID 139790705
1-[(E)-2-(4-ethylphenyl)-1,2-difluoroethenyl]-2-fluoro-4-pentylbenzene (PubChem CID 139790705) has the molecular formula C21H23F3 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-[(E)-2-(4-ethylphenyl)-1,2-difluoroethenyl]-2-fluoro-4-pentylbenzene.
| Compound Name | 1-[(E)-2-(4-ethylphenyl)-1,2-difluoroethenyl]-2-fluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 139790705 |
| Molecular Formula | C21H23F3 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(E)-2-(4-ethylphenyl)-1,2-difluoroethenyl]-2-fluoro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(/C(F)=C(\F)c2ccc(CC)cc2)c(F)c1 |
| InChI | InChI=1S/C21H23F3/c1-3-5-6-7-16-10-13-18(19(22)14-16)21(24)20(23)17-11-8-15(4-2)9-12-17/h8-14H,3-7H2,1-2H3/b21-20+ |
| InChIKey | DBFUAXSZOHHYQA-QZQOTICOSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|