C30H21F5 — CID 70896347
1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(3,4,5-trifluorophenyl)ethenyl]naphthalene (PubChem CID 70896347) has the molecular formula C30H21F5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(3,4,5-trifluorophenyl)ethenyl]naphthalene.
| Compound Name | 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(3,4,5-trifluorophenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 70896347 |
| Molecular Formula | C30H21F5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(3,4,5-trifluorophenyl)ethenyl]naphthalene |
| SMILES | CCCCc1ccc(C#Cc2ccc(/C(F)=C(\F)c3cc(F)c(F)c(F)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H21F5/c1-2-3-6-19-9-11-20(12-10-19)13-14-21-15-16-25(24-8-5-4-7-23(21)24)29(34)28(33)22-17-26(31)30(35)27(32)18-22/h4-5,7-12,15-18H,2-3,6H2,1H3/b29-28+ |
| InChIKey | KMTOEIBDRVMMDX-ZQHSETAFSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|