C32H34F2 — CID 122435256
4-[(E)-2-(4-butylphenyl)-1,2-difluoroethenyl]-1-[2-(4-butylphenyl)ethynyl]-2-ethylbenzene (PubChem CID 122435256) has the molecular formula C32H34F2 and a molecular weight of 456.62 g/mol. Its IUPAC name is 4-[(E)-2-(4-butylphenyl)-1,2-difluoroethenyl]-1-[2-(4-butylphenyl)ethynyl]-2-ethylbenzene.
| Compound Name | 4-[(E)-2-(4-butylphenyl)-1,2-difluoroethenyl]-1-[2-(4-butylphenyl)ethynyl]-2-ethylbenzene |
|---|---|
| PubChem CID | 122435256 |
| Molecular Formula | C32H34F2 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-[(E)-2-(4-butylphenyl)-1,2-difluoroethenyl]-1-[2-(4-butylphenyl)ethynyl]-2-ethylbenzene |
| SMILES | CCCCc1ccc(C#Cc2ccc(/C(F)=C(\F)c3ccc(CCCC)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C32H34F2/c1-4-7-9-24-11-13-26(14-12-24)15-18-28-21-22-30(23-27(28)6-3)32(34)31(33)29-19-16-25(17-20-29)10-8-5-2/h11-14,16-17,19-23H,4-10H2,1-3H3/b32-31+ |
| InChIKey | JGOVQSWKSYCHGC-QNEJGDQOSA-N |
| XLogP | 9.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|