C30H28F2 — CID 170900221
5-butyl-2-[2-[3-ethyl-4-[2-(4-ethylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 170900221) has the molecular formula C30H28F2 and a molecular weight of 426.55 g/mol. Its IUPAC name is 5-butyl-2-[2-[3-ethyl-4-[2-(4-ethylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-butyl-2-[2-[3-ethyl-4-[2-(4-ethylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 170900221 |
| Molecular Formula | C30H28F2 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-butyl-2-[2-[3-ethyl-4-[2-(4-ethylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | CCCCc1cc(F)c(C#Cc2ccc(C#Cc3ccc(CC)cc3)c(CC)c2)c(F)c1 |
| InChI | InChI=1S/C30H28F2/c1-4-7-8-25-20-29(31)28(30(32)21-25)18-15-24-14-17-27(26(6-3)19-24)16-13-23-11-9-22(5-2)10-12-23/h9-12,14,17,19-21H,4-8H2,1-3H3 |
| InChIKey | WPDMGBHJLQLFTA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|