C24H18F4 — CID 67683143
5-butyl-2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 67683143) has the molecular formula C24H18F4 and a molecular weight of 382.40 g/mol. Its IUPAC name is 5-butyl-2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-butyl-2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 67683143 |
| Molecular Formula | C24H18F4 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-butyl-2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | CCCCc1cc(F)c(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C24H18F4/c1-2-3-4-17-13-22(26)20(23(27)14-17)11-7-16-5-8-18(9-6-16)19-10-12-21(25)24(28)15-19/h5-6,8-10,12-15H,2-4H2,1H3 |
| InChIKey | UDFWIEBHQKQKKR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|