C28H24F2 — CID 54272628
5-[2-(4-butylphenyl)ethynyl]-2-[2-(4-ethylphenyl)ethynyl]-1,3-difluorobenzene (PubChem CID 54272628) has the molecular formula C28H24F2 and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-[2-(4-butylphenyl)ethynyl]-2-[2-(4-ethylphenyl)ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-butylphenyl)ethynyl]-2-[2-(4-ethylphenyl)ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 54272628 |
| Molecular Formula | C28H24F2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-[2-(4-butylphenyl)ethynyl]-2-[2-(4-ethylphenyl)ethynyl]-1,3-difluorobenzene |
| SMILES | CCCCc1ccc(C#Cc2cc(F)c(C#Cc3ccc(CC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H24F2/c1-3-5-6-22-11-13-23(14-12-22)15-16-25-19-27(29)26(28(30)20-25)18-17-24-9-7-21(4-2)8-10-24/h7-14,19-20H,3-6H2,1-2H3 |
| InChIKey | RLFMJLKUDLHAOX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|