C29H24F4O — CID 139757238
2-butoxy-5-[2-[2,6-difluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 139757238) has the molecular formula C29H24F4O and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-butoxy-5-[2-[2,6-difluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 2-butoxy-5-[2-[2,6-difluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139757238 |
| Molecular Formula | C29H24F4O |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-butoxy-5-[2-[2,6-difluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | CCCCOc1c(F)cc(C#Cc2c(F)cc(C#Cc3ccc(CCC)cc3)cc2F)cc1F |
| InChI | InChI=1S/C29H24F4O/c1-3-5-15-34-29-27(32)18-23(19-28(29)33)13-14-24-25(30)16-22(17-26(24)31)12-11-21-9-7-20(6-4-2)8-10-21/h7-10,16-19H,3-6,15H2,1-2H3 |
| InChIKey | XVXKTEZPACCQGM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|