C30H24F4O — CID 139858930
6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139858930) has the molecular formula C30H24F4O and a molecular weight of 476.51 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139858930 |
| Molecular Formula | C30H24F4O |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 6-[2-[4-[2-(4-butoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | CCCCOc1ccc(CCc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H24F4O/c1-2-3-14-35-25-11-7-20(8-12-25)4-5-22-16-27(31)26(28(32)17-22)13-9-21-6-10-23-18-29(33)30(34)19-24(23)15-21/h6-8,10-12,15-19H,2-5,14H2,1H3 |
| InChIKey | LVBXELLPDMHNGM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|