C28H21F4N — CID 139857102
2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-propylpyridine (PubChem CID 139857102) has the molecular formula C28H21F4N and a molecular weight of 447.48 g/mol. Its IUPAC name is 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-propylpyridine.
| Compound Name | 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-propylpyridine |
|---|---|
| PubChem CID | 139857102 |
| Molecular Formula | C28H21F4N |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-propylpyridine |
| SMILES | CCCc1ccc(CCc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C28H21F4N/c1-2-3-19-5-9-23(33-17-19)10-6-20-13-25(29)24(26(30)14-20)11-7-18-4-8-21-15-27(31)28(32)16-22(21)12-18/h4-5,8-9,12-17H,2-3,6,10H2,1H3 |
| InChIKey | VRUHGCZTVAMMGQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|