C29H22F5NO — CID 139857115
5-butoxy-2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine (PubChem CID 139857115) has the molecular formula C29H22F5NO and a molecular weight of 495.49 g/mol. Its IUPAC name is 5-butoxy-2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine.
| Compound Name | 5-butoxy-2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 139857115 |
| Molecular Formula | C29H22F5NO |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 5-butoxy-2-[2-[3,5-difluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine |
| SMILES | CCCCOc1ccc(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C29H22F5NO/c1-2-3-12-36-22-9-8-21(35-17-22)7-4-19-14-25(30)24(26(31)15-19)11-6-18-5-10-23-20(13-18)16-27(32)29(34)28(23)33/h5,8-10,13-17H,2-4,7,12H2,1H3 |
| InChIKey | FTKKPZRYMNVQSL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|