C31H24F6O — CID 139859072
6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139859072) has the molecular formula C31H24F6O and a molecular weight of 526.52 g/mol. Its IUPAC name is 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139859072 |
| Molecular Formula | C31H24F6O |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 6-[2-[4-[2-(2,6-difluoro-4-pentoxyphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | CCCCCOc1cc(F)c(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H24F6O/c1-2-3-4-13-38-22-17-29(35)25(30(36)18-22)11-7-20-15-27(33)24(28(34)16-20)10-6-19-5-9-23-21(14-19)8-12-26(32)31(23)37/h5,8-9,12,14-18H,2-4,7,11,13H2,1H3 |
| InChIKey | RJUUWYMFSWBEOM-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|