C29H22F4O — CID 139859380
6-[2-[4-[2-(2,6-difluoro-4-propoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139859380) has the molecular formula C29H22F4O and a molecular weight of 462.49 g/mol. Its IUPAC name is 6-[2-[4-[2-(2,6-difluoro-4-propoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(2,6-difluoro-4-propoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139859380 |
| Molecular Formula | C29H22F4O |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 6-[2-[4-[2-(2,6-difluoro-4-propoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | CCCOc1cc(F)c(CCc2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C29H22F4O/c1-2-13-34-24-17-26(30)25(27(31)18-24)12-10-20-5-3-19(4-6-20)7-8-21-9-11-22-15-28(32)29(33)16-23(22)14-21/h3-6,9,11,14-18H,2,10,12-13H2,1H3 |
| InChIKey | AFRGBTVVLBKZIJ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|