C28H20F4O — CID 139858779
6-[2-[4-(4-butoxy-2,6-difluorophenyl)phenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139858779) has the molecular formula C28H20F4O and a molecular weight of 448.46 g/mol. Its IUPAC name is 6-[2-[4-(4-butoxy-2,6-difluorophenyl)phenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-(4-butoxy-2,6-difluorophenyl)phenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139858779 |
| Molecular Formula | C28H20F4O |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 6-[2-[4-(4-butoxy-2,6-difluorophenyl)phenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | CCCCOc1cc(F)c(-c2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C28H20F4O/c1-2-3-14-33-22-16-25(30)27(26(31)17-22)20-9-6-18(7-10-20)4-5-19-8-12-23-21(15-19)11-13-24(29)28(23)32/h6-13,15-17H,2-3,14H2,1H3 |
| InChIKey | ONBHPMNOWSYYHW-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|