C27H19F3O — CID 139857356
1,2-difluoro-6-[2-[4-(2-fluoro-4-propoxyphenyl)phenyl]ethynyl]naphthalene (PubChem CID 139857356) has the molecular formula C27H19F3O and a molecular weight of 416.44 g/mol. Its IUPAC name is 1,2-difluoro-6-[2-[4-(2-fluoro-4-propoxyphenyl)phenyl]ethynyl]naphthalene.
| Compound Name | 1,2-difluoro-6-[2-[4-(2-fluoro-4-propoxyphenyl)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139857356 |
| Molecular Formula | C27H19F3O |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1,2-difluoro-6-[2-[4-(2-fluoro-4-propoxyphenyl)phenyl]ethynyl]naphthalene |
| SMILES | CCCOc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C27H19F3O/c1-2-15-31-22-11-13-23(26(29)17-22)20-8-5-18(6-9-20)3-4-19-7-12-24-21(16-19)10-14-25(28)27(24)30/h5-14,16-17H,2,15H2,1H3 |
| InChIKey | YDBHQYBSMBIVDE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|