C35H28F2O — CID 134376480
2-[3-fluoro-5-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(2-fluoro-4-propoxyphenyl)naphthalene (PubChem CID 134376480) has the molecular formula C35H28F2O and a molecular weight of 502.60 g/mol. Its IUPAC name is 2-[3-fluoro-5-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(2-fluoro-4-propoxyphenyl)naphthalene.
| Compound Name | 2-[3-fluoro-5-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(2-fluoro-4-propoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 134376480 |
| Molecular Formula | C35H28F2O |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-[3-fluoro-5-methyl-4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(2-fluoro-4-propoxyphenyl)naphthalene |
| SMILES | CCCOc1ccc(-c2ccc3cc(-c4cc(C)c(C#Cc5ccc(C)cc5)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C35H28F2O/c1-4-17-38-31-14-16-33(35(37)22-31)29-13-12-26-19-28(11-10-27(26)20-29)30-18-24(3)32(34(36)21-30)15-9-25-7-5-23(2)6-8-25/h5-8,10-14,16,18-22H,4,17H2,1-3H3 |
| InChIKey | QEAMKHHVMJJNKO-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|