C23H16F4O — CID 67685723
2-[2-(3,4-difluorophenyl)ethynyl]-1,3-difluoro-5-(4-propoxyphenyl)benzene (PubChem CID 67685723) has the molecular formula C23H16F4O and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)ethynyl]-1,3-difluoro-5-(4-propoxyphenyl)benzene.
| Compound Name | 2-[2-(3,4-difluorophenyl)ethynyl]-1,3-difluoro-5-(4-propoxyphenyl)benzene |
|---|---|
| PubChem CID | 67685723 |
| Molecular Formula | C23H16F4O |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)ethynyl]-1,3-difluoro-5-(4-propoxyphenyl)benzene |
| SMILES | CCCOc1ccc(-c2cc(F)c(C#Cc3ccc(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H16F4O/c1-2-11-28-18-7-5-16(6-8-18)17-13-21(25)19(22(26)14-17)9-3-15-4-10-20(24)23(27)12-15/h4-8,10,12-14H,2,11H2,1H3 |
| InChIKey | UPPDZBHOHPTSIL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|