C29H18F4O — CID 139858835
2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-propoxyphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139858835) has the molecular formula C29H18F4O and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-propoxyphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-propoxyphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139858835 |
| Molecular Formula | C29H18F4O |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-propoxyphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | CCCOc1ccc(C#Cc2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H18F4O/c1-2-13-34-25-11-9-21(27(31)18-25)6-4-20-15-28(32)26(29(33)16-20)12-5-19-3-7-23-17-24(30)10-8-22(23)14-19/h3,7-11,14-18H,2,13H2,1H3 |
| InChIKey | NACDQTDYMGKQLV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|